A0609712
2-Amino-5-nitrobenzophenone , 98% , 1775-95-7
CAS NO.:1775-95-7
Empirical Formula: C13H10N2O3
Molecular Weight: 242.23
MDL number: MFCD00007364
EINECS: 217-207-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB478.40 | In Stock |
|
| 500g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-168 °C (lit.) |
| Boiling point: | 385.05°C (rough estimate) |
| Density | 1.2480 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | -2.26±0.36(Predicted) |
| color | Beige |
| Water Solubility | 3 mg/L (20 C) |
| InChI | InChI=1S/C13H10N2O3/c14-12-7-6-10(15(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,14H2 |
| InChIKey | PZPZDEIASIKHPY-UHFFFAOYSA-N |
| SMILES | C(C1=CC([N+]([O-])=O)=CC=C1N)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 1775-95-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (2-amino-5-nitrophenyl)phenyl-(1775-95-7) |
Description and Uses
2-Amino-5-nitrobenzophenone was used in the synthesis of [5-(4-nitrophenyl)-2-furyl]acrylic acid substituted benzophenone (anti-malarial agent).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | PC4935000 |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





