A0610912
5-Azacytosine , 98% , 931-86-2
Synonym(s):
5-Azacytosine;2-Hydroxy-4-aminotriazine;4-Amino-1,3,5-triazin-2-ol;4-Amino-1,3,5-triazin-2-one;4-Amino-2-hydroxy-1,3,5-triazine
CAS NO.：931-86-2
Empirical Formula: C3H4N4O
Molecular Weight: 112.09
MDL number: MFCD00006033
EINECS: 213-242-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB77.60 | In Stock |
|
| 100G | RMB273.60 | In Stock |
|
| 500G | RMB1108.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 209.98°C (rough estimate) |
| Density | 1.86 |
| refractive index | 1.8010 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Aqueous Base (Slightly, Heated), DMSO (Slightly, Heated) |
| pka | 7.61±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 116378 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C3H4N4O/c4-2-5-1-6-3(8)7-2/h1H,(H3,4,5,6,7,8) |
| InChIKey | MFEFTTYGMZOIKO-UHFFFAOYSA-N |
| SMILES | N1C(N)=NC=NC1=O |
| CAS DataBase Reference | 931-86-2(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Enzymic synthesis of nucleoside analogs using immobilized 2′-deoxyribosyltransferase from Lactobacillus reuteri
- Reactions with oxide radical ion
- Potential antitumor and antiproliferative agent against human leukemia cells
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | XZ2854300 |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
