PRODUCT Properties
| Melting point: | 120 °C |
| Boiling point: | 402.6±30.0 °C(Predicted) |
| Density | 1.208±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetonitrile: Slightly Soluble Water: Slightly Soluble |
| form | Solid |
| pka | 3.16±0.10(Predicted) |
| color | White to off-white |
| InChI | 1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m1/s1 |
| InChIKey | DEFJQIDDEAULHB-QWWZWVQMSA-N |
| SMILES | C[C@@H](N)C(=O)N[C@H](C)C(O)=O |
| CAS DataBase Reference | 923-16-0(CAS DataBase Reference) |
Description and Uses
D-Ala-D-Ala is a bacterial endogenous metabolite. D-Ala-D-Ala constitutes the terminus of the peptide part of the peptidoglycan monomer unit and is involved in the transpeptidation reaction as the substrate. D-Ala-D-Ala is catalyzed by D-Alanine-D-Alanine ligase[1][2][3].
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
