A0616212
6-Aminoquinoxaline , 95% , 6298-37-9
Synonym(s):
Quinoxalin-6-amine
CAS NO.：6298-37-9
Empirical Formula: C8H7N3
Molecular Weight: 145.16
MDL number: MFCD00462821
EINECS: 662-890-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB112.00 | In Stock |
|
| 25G | RMB372.80 | In Stock |
|
| 100G | RMB1209.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159 °C |
| Boiling point: | 254.27°C (rough estimate) |
| Density | 1.2109 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.57±0.30(Predicted) |
| color | Yellow to Dark Yellow |
| InChI | InChI=1S/C8H7N3/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H,9H2 |
| InChIKey | MSGRFBKVMUKEGZ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(N)=CC=2)N=CC=1 |
| CAS DataBase Reference | 6298-37-9(CAS DataBase Reference) |
Description and Uses
6-Quinoxalinamine is used in the synthetic preparation and evaluation of novel nitroheterocyclic hypoxic markers for solid tumor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36/38-22 |
| Safety Statements | 24/25-36/39-26 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
