A0616312
(S)-4-(4-Aminobenzyl)-2(1H)-oxazolidinone , 98% , 152305-23-2
Synonym(s):
(S)-4-(4-Aminobenzyl)-2(1H)-oxazolidinone;(4S)-4-[(4-Aminophenyl)methyl]-2-oxazolidinone
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-111 °C |
| Boiling point: | 479.7±14.0 °C(Predicted) |
| Density | 1.257±0.06 g/cm3(Predicted) |
| refractive index | -6.0 ° (C=1, MeOH) |
| storage temp. | 2-8°C |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| pka | 12.67±0.40(Predicted) |
| form | Solid |
| color | White to Brown |
| InChI | 1S/C10H12N2O2/c11-8-3-1-7(2-4-8)5-9-6-14-10(13)12-9/h1-4,9H,5-6,11H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | WNAVSKJKDPLWBD-VIFPVBQESA-N |
| SMILES | Nc1ccc(C[C@H]2COC(=O)N2)cc1 |
| CAS DataBase Reference | 152305-23-2(CAS DataBase Reference) |
Description and Uses
(S)-4-(4-Aminobenzyl)-2-(1H)-oxazolidinone is an intermediate of zolmitriptan (sc-220415) which acts as a novel inhibitor of the cytochrome P-450 enzyme aromatase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 2 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







