A0616612
4-(2-Aminoethyl)benzenesulfonamide , 99% , 35303-76-5
CAS NO.:35303-76-5
Empirical Formula: C8H12N2O2S
Molecular Weight: 200.26
MDL number: MFCD00010301
EINECS: 252-501-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB152.00 | In Stock |
|
| 500G | RMB692.00 | In Stock |
|
| 2.5kg | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-152 °C (lit.) |
| Boiling point: | 387.4±44.0 °C(Predicted) |
| Density | 1.2581 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5690 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.16±0.10(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | 15.5g/L at 20℃ |
| InChI | InChI=1S/C8H12N2O2S/c9-6-5-7-1-3-8(4-2-7)13(10,11)12/h1-4H,5-6,9H2,(H2,10,11,12) |
| InChIKey | FXNSVEQMUYPYJS-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(CCN)C=C1 |
| LogP | -3.1 at 19.8℃ |
| CAS DataBase Reference | 35303-76-5(CAS DataBase Reference) |
Description and Uses
4-(2-Aminoethyl)benzenesulfonamide was used to develop a model system to study the implementation of a microfluid chip required for Fourier transform measurements of biochemical interactions.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Warning |
| Hazard statements | H290-H315-H319 |
| Precautionary statements | P234-P264-P280-P302+P352-P305+P351+P338-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 34-22-36/37/38-20/21/22 |
| Safety Statements | 45-36/37/39-26-36-24/25 |
| RIDADR | UN3259 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29350090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Met. Corr. 1 Skin Irrit. 2 |







