A0618212
3-Amino-5-bromo-2-chloropyridine , 97% , 588729-99-1
CAS NO.：588729-99-1
Empirical Formula: C5H4BrClN2
Molecular Weight: 207.46
MDL number: MFCD02682092
EINECS: 675-552-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB46.40 | In Stock |
|
| 25G | RMB167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-132℃ |
| Boiling point: | 296.8±35.0 °C(Predicted) |
| Density | 1.834±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 0.03±0.10(Predicted) |
| color | White to Orange to Green |
| λmax | 314nm(EtOH)(lit.) |
| InChI | InChI=1S/C5H4BrClN2/c6-3-1-4(8)5(7)9-2-3/h1-2H,8H2 |
| InChIKey | ZSEZSALOLWCCGT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Br)C=C1N |
| CAS DataBase Reference | 588729-99-1(CAS DataBase Reference) |
Description and Uses
3-Amino-5-bromo-2-chloropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 25-37/38-41-22 |
| Safety Statements | 26-39-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
