A0619312
Ammonium citrate dibasic , AR,98% , 3012-65-5
Synonym(s):
di-Ammonium hydrogen citrate;Diammonium hydrogen citrate;Citric acid ammonium salt;Citric acid triammonium salt;Ammonium citrate dibasic, Diammonium hydrogen citrate
CAS NO.:3012-65-5
Empirical Formula: C6H14N2O7
Molecular Weight: 226.18
MDL number: MFCD00013068
EINECS: 221-146-3
| Pack Size | Price | Stock | Quantity |
| 500G | RMB26.40 | In Stock |
|
| 2.5kg | RMB119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185 °C (dec.)(lit.) |
| Boiling point: | 100 °C(lit.) |
| bulk density | 400-600kg/m3 |
| Density | 1.22 g/mL at 20 °C |
| vapor density | 1.8 (vs air) |
| refractive index | 1.4650 (estimate) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | Solid |
| color | White |
| PH | 5.48(1 mM solution);5.29(10 mM solution);5.04(100 mM solution);6.16(1000 mM solution) |
| Odor | Slight ammonia odor |
| PH Range | 5.2 |
| Water Solubility | Soluble in water. Slightiy soluble in alcohol. |
| λmax | λ: 260 nm Amax: ≤0.05 λ: 280 nm Amax: ≤0.03 |
| Merck | 14,512 |
| BRN | 4925760 |
| Stability: | Stable. |
| Cosmetics Ingredients Functions | BUFFERING CHELATING |
| Cosmetic Ingredient Review (CIR) | Ammonium citrate dibasic (3012-65-5) |
| InChI | 1S/C6H8O7.2H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*1H3 |
| InChIKey | YXVFQADLFFNVDS-UHFFFAOYSA-N |
| SMILES | N.N.OC(=O)CC(O)(CC(O)=O)C(O)=O || N.N.OC(=O)CC(O)(CC(O)=O)C(O)=O |
| LogP | -2.840 |
| CAS DataBase Reference | 3012-65-5(CAS DataBase Reference) |
| EPA Substance Registry System | Diammonium citrate (3012-65-5) |
Description and Uses
Ammonium citrate dibasic is generally used as a component of matrix solution in matrix-assisted laser desorption/ionization time-of-flight (MALDI-TOF) mass spectrometry analysis. It can also be used as both the carbon and nitrogen source to synthesize fluorescent nitrogen-doped carbon nanoparticles (CNPs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/37 |
| Safety Statements | 26-36 |
| RIDADR | UN 9087 |
| WGK Germany | 3 |
| RTECS | GE7545000 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29181500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 3012-65-5(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





