A0620212
2-Amino-3-chloro-5-(trifluoromethyl)pyridine , 97% , 79456-26-1
CAS NO.:79456-26-1
Empirical Formula: C6H4ClF3N2
Molecular Weight: 196.56
MDL number: MFCD00042154
EINECS: 401-670-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB88.00 | In Stock |
|
| 100G | RMB274.40 | In Stock |
|
| 500g | RMB927.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-90 °C (lit.) |
| Boiling point: | 205°C |
| Density | 1.4650 (estimate) |
| vapor pressure | 40.8Pa at 24.85℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 1.79±0.49(Predicted) |
| color | White to off-white |
| Water Solubility | 622mg/L at 25℃ |
| InChI | InChI=1S/C6H4ClF3N2/c7-4-1-3(6(8,9)10)2-12-5(4)11/h1-2H,(H2,11,12) |
| InChIKey | WXNPZQIRDCDLJD-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(C(F)(F)F)C=C1Cl |
| LogP | 2.59 at 20℃ |
| CAS DataBase Reference | 79456-26-1(CAS DataBase Reference) |
Description and Uses
2-Amino-3-chloro-5-trifluoromethylpyridine acts as a reactant in the synthesis of novel imidazo[1,2-a]pyridine-coumarin hybrid molecules as inhibitors of NS5B in potential treatment of Hepititis C.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-52/53-36/37/38-20/21/22 |
| Safety Statements | 61-36/37/39-26-22 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |





