A0620312
3-Amino-4-pyrazolecarboxamide hemisulfate salt , 98% , 27511-79-1
Synonym(s):
3-Amino-4-pyrazolecarboxamide hemisulfate salt
CAS NO.:27511-79-1
Empirical Formula: C8H14N8O6S
Molecular Weight: 350.31
MDL number: MFCD00013093
EINECS: 248-503-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB81.60 | In Stock |
|
| 100G | RMB272.00 | In Stock |
|
| 500g | RMB1343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224 °C (dec.)(lit.) |
| Density | 0.84 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly), Water (Slightly, Heated, Sonicated) |
| form | Solid |
| color | White to Pale Brown |
| BRN | 3767200 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/2C4H6N4O.H2O4S/c2*5-3-2(4(6)9)1-7-8-3;1-5(2,3)4/h2*1H,(H2,6,9)(H3,5,7,8);(H2,1,2,3,4) |
| InChIKey | UMPKASYMNORSRO-UHFFFAOYSA-N |
| SMILES | C1(C(=O)N)=CNN=C1N.C1(C(=O)N)=CNN=C1N.S(=O)(=O)(O)O |
Description and Uses
3-Amino-4-pyrazolecarboxamide hemisulfate salt was used to prepare 3-carbamoyl derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |







