A0620512
4-Amino-2-bromopyridine , 97% , 7598-35-8
Synonym(s):
2-Bromo-4-pyridinamine
CAS NO.:7598-35-8
Empirical Formula: C5H5BrN2
Molecular Weight: 173.01
MDL number: MFCD01646061
EINECS: 629-178-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB270.40 | In Stock |
|
| 25G | RMB692.80 | In Stock |
|
| 100G | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-96 °C |
| Boiling point: | 321.3±22.0 °C(Predicted) |
| Density | 1.710±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder or Powder |
| pka | 4.89±0.30(Predicted) |
| color | White to pale brown to orange |
| Water Solubility | Slightly soluble in water. |
| BRN | 108928 |
| InChI | InChI=1S/C5H5BrN2/c6-5-3-4(7)1-2-8-5/h1-3H,(H2,7,8) |
| InChIKey | GNTGEMWEXKBWBX-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(N)=C1 |
| CAS DataBase Reference | 7598-35-8(CAS DataBase Reference) |
Description and Uses
4-Amino-2-bromopyridine is used as medical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36/37/38-36-36/37 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





