A0620712
Adonitol , 99% , 488-81-3
CAS NO.:488-81-3
Empirical Formula: C5H12O5
Molecular Weight: 152.15
MDL number: MFCD00064291
EINECS: 207-685-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB423.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| 500g | RMB5439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-105 °C |
| Boiling point: | 194.6°C (rough estimate) |
| Density | 1.1497 (rough estimate) |
| refractive index | 1.3920 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 5mg/mL; DMSO: 25mg/mL; PBS (pH 7.2): 5mg/mL |
| form | Fine Crystalline Powder |
| pka | 13.24±0.20(Predicted) |
| color | White |
| PH | 5.5-7.0 (100g/l, H2O, 25℃) |
| Water Solubility | Soluble in water (100 mg/ml). |
| Sensitive | Hygroscopic |
| Merck | 14,168 |
| BRN | 1720524 |
| Henry's Law Constant | 4.6×1011 mol/(m3Pa) at 25℃, Compernolle and Müller (2014) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
| InChIKey | HEBKCHPVOIAQTA-ZXFHETKHSA-N |
| SMILES | OC[C@H](O)[C@H](O)[C@H](O)CO |
| LogP | -3.770 (est) |
| CAS DataBase Reference | 488-81-3(CAS DataBase Reference) |
| EPA Substance Registry System | Ribitol (488-81-3) |
Description and Uses
A sugar alcohol formed by the reduction of ribose
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P501-P260-P270-P271-P264-P280-P362+P364-P303+P361+P353-P301+P330+P331-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | VJ0800000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29054990 |
| Storage Class | 11 - Combustible Solids |




