A0621912
5-Amino-1-naphthalenesulfonic acid , 90% , 84-89-9
Synonym(s):
1-Naphthylamine-5-sulfonic acid;Laurent’s acid
CAS NO.：84-89-9
Empirical Formula: C10H9NO3S
Molecular Weight: 223.25
MDL number: MFCD00014315
EINECS: 201-571-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100g | RMB60.00 | In Stock |
|
| 500g | RMB199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 220°C (rough estimate) |
| Density | 1.3588 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| solubility | Aqueous Base (Slightly), DMSO (Slightly) |
| pka | pK1: 3.69 (25°C) |
| form | powder to crystal |
| color | Purple to Dark purple to Dark red |
| Water Solubility | Soluble in hot water. |
| Merck | 14,6404 |
| BRN | 2214149 |
| InChI | 1S/C10H9NO3S/c11-9-5-1-4-8-7(9)3-2-6-10(8)15(12,13)14/h1-6H,11H2,(H,12,13,14) |
| InChIKey | DQNAQOYOSRJXFZ-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c(cccc12)S(O)(=O)=O |
| CAS DataBase Reference | 84-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenesulfonic acid, 5-amino- (84-89-9) |
Description and Uses
5-Aminonaphthalene-1-sulfonic acid is an deriva- tizing agents in the precolumn derivatization of some chiral phenoxy acid. Cu(II) based on a dansyl derivative was synthesized with 29.2% overall yield by a seven-step synthetic procedure from the readily available starting material 5-aminonaphthalene-1-sulfonic acid.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H335-H312-H314-H332-H315-H319 |
| Precautionary statements | P280g-P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 3 |
| RTECS | QK1270500 |
| TSCA | TSCA listed |
| HS Code | 2921.45.2000 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
