A0632856
9-(3-Bromophenyl)carbazole , >99% , 185112-61-2
CAS NO.:185112-61-2
Empirical Formula: C18H12BrN
Molecular Weight: 322.2
MDL number: MFCD20486475
EINECS: 807-965-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB55.20 | In Stock |
|
| 5g | RMB143.20 | In Stock |
|
| 25g | RMB559.20 | In Stock |
|
| 100g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-70℃ |
| Boiling point: | 463℃ |
| Density | 1.39 |
| Flash point: | 234℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C18H12BrN/c19-13-6-5-7-14(12-13)20-17-10-3-1-8-15(17)16-9-2-4-11-18(16)20/h1-12H |
| InChIKey | ZKGHGKNHPPZALY-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC(Br)=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
Description and Uses
9-(3-bromophenyl)carbazole can be used to synthesize organic optoelectronic materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933.99.8290 |





