A0637212
5-Aminoorotic Acid , 98% , 7164-43-4
Synonym(s):
5-Amino-2,6-dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid;5-Amino-6-carboxy-2,4-dihydroxypyrimidine
CAS NO.:7164-43-4
Empirical Formula: C5H5N3O4
Molecular Weight: 171.11
MDL number: MFCD00010563
EINECS: 230-514-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB370.40 | In Stock |
|
| 500G | RMB1409.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Density | 1.700±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 0.53±0.20(Predicted) |
| form | powder to crystal |
| color | White to Amber |
| InChI | InChI=1S/C5H5N3O4/c6-1-2(4(10)11)7-5(12)8-3(1)9/h6H2,(H,10,11)(H2,7,8,9,12) |
| InChIKey | HWCXJKLFOSBVLH-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(=O)C(N)=C(C(O)=O)N1 |
| CAS DataBase Reference | 7164-43-4(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Pyrimidinecarboxylic acid, 5-amino-1,2,3,6-tetrahydro-2,6-dioxo- (7164-43-4) |
Description and Uses
5-Aminoorotic acid was used as an internal standard during the electrochemical determination of orotic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/38 |
| WGK Germany | 3 |
| RTECS | RM3190000 |
| TSCA | TSCA listed |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




