A0638656
9-PhenanthreneboronicAcid(containsvaryingamountsofAnhydride) , 98% , 68572-87-2
Synonym(s):
Phenanthracene-9-boronic acid
CAS NO.：68572-87-2
Empirical Formula: C14H11BO2
Molecular Weight: 222.05
MDL number: MFCD00143524
EINECS: 627-783-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB159.20 | In Stock |
|
| 5g | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-170 °C |
| Boiling point: | 479.5±28.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO. |
| pka | 8.53±0.30(Predicted) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C14H11BO2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,16-17H |
| InChIKey | JCDAUYWOHOLVMH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2C(C3C1=CC=CC=3)=CC=CC=2)(O)O |
| CAS DataBase Reference | 68572-87-2(CAS DataBase Reference) |
Description and Uses
9-Phenanthracenylboronic acid is used as an fluorescent analytical reagent in sensing systems for glucose-specific detection and in suzuki reaction.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
