A0640912
N-Acetyle-D-Leucine , 99% , 19764-30-8
CAS NO.：19764-30-8
Empirical Formula: C8H15NO3
Molecular Weight: 173.21
MDL number: MFCD00066069
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 100G | RMB387.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-177C |
| Boiling point: | 369.7±25.0 °C(Predicted) |
| Density | 1.069±0.06 g/cm3(Predicted) |
| refractive index | 23 ° (C=4, EtOH) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| pka | 3.67±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C8H15NO3/c1-5(2)4-7(8(11)12)9-6(3)10/h5,7H,4H2,1-3H3,(H,9,10)(H,11,12)/t7-/m1/s1 |
| InChIKey | WXNXCEHXYPACJF-SSDOTTSWSA-N |
| SMILES | C(O)(=O)[C@@H](CC(C)C)NC(C)=O |
| CAS DataBase Reference | 19764-30-8(CAS DataBase Reference) |
Description and Uses
N-Acetyl-D-leucine may be used with other D-aminoacylated amino acids as a substrate for the identification, differentiation and characterization of D-aminoacylase(s)/amidohydrolase(s).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H320-H335 |
| Precautionary statements | P264-P270-P301+P312-P330 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29241900 |
