A0642150
5alpha-Androst-16-en-3-one , 98% , 18339-16-7
Synonym(s):
16-(5α)Androsten-3-one;3-Keto-5α,16-androstene;Androstenone
CAS NO.:18339-16-7
Empirical Formula: C19H28O
Molecular Weight: 272.42
MDL number: MFCD00010479
EINECS: 242-220-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB360.00 | In Stock |
|
| 500mg | RMB1375.20 | In Stock |
|
| 1g | RMB2047.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-145 °C(lit.) |
| Boiling point: | 371.6±42.0 °C(Predicted) |
| Density | 1.032±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | White to Off-White |
| biological source | synthetic (organic) |
| InChI | InChI=1/C19H28O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13,15-17H,4-8,10-12H2,1-2H3/t13-,15-,16-,17-,18-,19-/s3 |
| InChIKey | HFVMLYAGWXSTQI-QYXZOKGRSA-N |
| SMILES | [C@]12([H])CC[C@]3(C)C=CC[C@@]3([H])[C@]1([H])CC[C@@]1([H])CC(=O)CC[C@]21C |&1:0,4,9,11,15,22,r| |
| LogP | 5.568 (est) |
| CAS DataBase Reference | 18339-16-7(CAS DataBase Reference) |
Description and Uses
5α-Androst-16-en-3-one has been used:
- to quantify its concentration in various fat tissues
- to study its trigeminal percept and implications on the rate of specific anosmia
- to study the effects of immunocastration on meat quality and sensory properties of pork bellies
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Danger |
| Hazard statements | H312-H302-H361-H332-H351 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P264-P270-P301+P312-P330-P501-P201-P202-P281-P308+P313-P405-P501-P280-P302+P352-P312-P322-P363-P501-P261-P271-P304+P340-P312 |
| WGK Germany | - |







