A0643612
2-Acrylamido-2-methyl-1-propanesulfonic acid , 98% , 15214-89-8
Synonym(s):
2-Acrylamido-2-methylpropanesulfonic acid
CAS NO.:15214-89-8
Empirical Formula: C7H13NO4S
Molecular Weight: 207.25
MDL number: MFCD00007522
EINECS: 239-268-0
| Pack Size | Price | Stock | Quantity |
| 100G | RMB32.00 | In Stock |
|
| 500G | RMB98.40 | In Stock |
|
| 2.5KG | RMB395.20 | In Stock |
|
| 10kg | RMB1372.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195 °C (dec.) (lit.) |
| Density | 1.45 |
| bulk density | 640kg/m3 |
| vapor pressure | <0.0000004 hPa (25 °C) |
| refractive index | 1.6370 (estimate) |
| Flash point: | 160 °C |
| storage temp. | Store below +30°C. |
| solubility | >500g/l soluble |
| pka | 1.67±0.50(Predicted) |
| form | solution |
| color | White |
| Water Solubility | 1500 g/L (20 ºC) |
| Sensitive | Hygroscopic |
| BRN | 1946464 |
| Stability: | Light Sensitive |
| InChI | 1S/C7H13NO4S/c1-4-6(9)8-7(2,3)5-13(10,11)12/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12) |
| InChIKey | HNKOEEKIRDEWRG-UHFFFAOYSA-N |
| SMILES | CC(C)(CS(O)(=O)=O)NC(=O)C=C |
| LogP | -3.7 at 20℃ and pH1-7 |
| Surface tension | 70.5mN/m at 1g/L and 20℃ |
| Dissociation constant | 2.4 at 20℃ |
| CAS DataBase Reference | 15214-89-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanesulfonic acid, 2-methyl-2-[(1-oxo-2-propenyl)amino]- (15214-89-8) |
Description and Uses
2-Acrylamide-2-methylpropanesulfonic acid has good complexion, adsorption, biological activity, surface activity, hydrolysis stability and thermal stability. It can be used in oil chemical, water treatment, synthetic fiber, printing and dyeing, plastics, water absorbing coatings, paper, bio-medical, magnetic materials and cosmetics industries.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H332-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xn |
| Risk Statements | 34-21/22-41-37-20/22 |
| Safety Statements | 26-36/37/39-45-22 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 1 |
| RTECS | TZ6658000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29241900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 STOT SE 3 |
| Toxicity | LD50 orally in Rabbit: 1000 - 2000 mg/kg |







