A0643912
Aluminum sec-butoxide , 95% , 2269-22-9
Synonym(s):
Aluminium tri-sec-butanolate, Aluminium sec-butoxide;Aluminium tri-sec-butylate;Aluminum sec-butoxide
CAS NO.:2269-22-9
Empirical Formula: C4H13AlO
Molecular Weight: 104.13
MDL number: MFCD00009327
EINECS: 218-871-2
| Pack Size | Price | Stock | Quantity |
| 100G | RMB43.20 | In Stock |
|
| 500G | RMB157.60 | In Stock |
|
| 2.5KG | RMB1183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 40 °C |
| Density | 0.967 g/mL at 25 °C(lit.) |
| vapor pressure | 23 hPa (195 °C) |
| refractive index | 1.4390 |
| Flash point: | 82 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with alcohol, isopropyl alcohol and toluene. |
| form | Oily Liquid |
| Specific Gravity | 0.9671 |
| color | Light yellow |
| explosive limit | 1.7-9.8%(V) |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3910908 |
| Stability: | Stability Stable, but may decompose upon exposure to air and moisture. Flammable. Incompatible with strong oxidizing agents, strong acids, water. |
| Cosmetics Ingredients Functions | LIGHT STABILIZER |
| InChI | 1S/3C4H9O.Al/c3*1-3-4(2)5;/h3*4H,3H2,1-2H3;/q3*-1;+3 |
| InChIKey | WOZZOSDBXABUFO-UHFFFAOYSA-N |
| SMILES | CCC(C)O[Al](OC(C)CC)OC(C)CC |
| CAS DataBase Reference | 2269-22-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Aluminum tri-sec-butoxide(2269-22-9) |
| EPA Substance Registry System | 2-Butanol, aluminum salt (2269-22-9) |
Description and Uses
It is used for active catalyst and support, inorganic membrane, redrcing agent of aldehyde-ketone, oxidant of aldehyde-ketone, gel forming agent of printing ink and paint, dehydrant, water proofing agent and aluminum base grease.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H302-H311 |
| Precautionary statements | P210-P280-P301+P312+P330-P302+P352+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 40-21/22-10 |
| Safety Statements | 36/37-45-43-36/37/39-26-16 |
| RIDADR | UN 1992 3/PG 3 |
| WGK Germany | 3 |
| F | 3-10-23 |
| Autoignition Temperature | 763 °F |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29051900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Flam. Liq. 3 |
| Toxicity | LD50 orally in Rabbit: 401 mg/kg LD50 dermal Rabbit 402 mg/kg |





