A0644656
AnilofosSolutioninMethanol , 100 μg/mlinmethanol, uncertainty 3% , 64249-01-0
Synonym(s):
S-[2-(4-Chloro-N-isopropylanilino)-2-oxoethyl]-O,O′-dimethyl dithiophosphate
CAS NO.:64249-01-0
Empirical Formula: C13H19ClNO3PS2
Molecular Weight: 367.85
MDL number: MFCD01311803
EINECS: 264-756-5
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB367.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50~55℃ |
| Boiling point: | 443.6±55.0 °C(Predicted) |
| Density | 1.322±0.06 g/cm3(Predicted) |
| Flash point: | >100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -0.48±0.50(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 2395778 |
| Major Application | agriculture environmental |
| InChI | 1S/C13H19ClNO3PS2/c1-10(2)15(12-7-5-11(14)6-8-12)13(16)9-21-19(20,17-3)18-4/h5-8,10H,9H2,1-4H3 |
| InChIKey | NXQDBZGWYSEGFL-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)SCC(=O)N(C(C)C)c1ccc(Cl)cc1 |
| CAS DataBase Reference | 64249-01-0(CAS DataBase Reference) |
Description and Uses
Agricultural chemical.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-51/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | TD5185000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orl-rat: 472 mg/kg PEMNDP 9,36,1991 |



