A0647812
3-Amino-2-methylbenzoic acid , 97% , 52130-17-3
Synonym(s):
3-Amino-o-toluic acid
CAS NO.：52130-17-3
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00075026
EINECS: 213-446-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB58.40 | In Stock |
|
| 100G | RMB188.00 | In Stock |
|
| 500G | RMB709.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-181 °C(lit.) |
| Boiling point: | 273.17°C (rough estimate) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | almost transparency in hot Methanol |
| form | powder to crystal |
| pka | 3.09±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 2803090 |
| InChI | InChI=1S/C8H9NO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | BYHMLZGICSEKIY-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(N)=C1C |
| CAS DataBase Reference | 52130-17-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280h |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29224999 |
