A0648212
2-Acetamidophenol , 99% , 614-80-2
Synonym(s):
N-(2-Hydroxyphenyl)acetamide;2′-Hydroxyacetanilide;2-Acetamidophenol;NSC 3989
CAS NO.:614-80-2
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00002181
EINECS: 210-396-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB75.20 | In Stock |
|
| 500g | RMB343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-210 °C(lit.) |
| Boiling point: | 273.17°C (rough estimate) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 9.35±0.35(Predicted) |
| color | Off-white to beige to brown |
| BRN | 607592 |
| Stability: | Stable. Incompatible with strong oxidizing agents, chloroformates, acids, acid chlorides, acid anhydrides. |
| InChI | InChI=1S/C8H9NO2/c1-6(10)9-7-4-2-3-5-8(7)11/h2-5,11H,1H3,(H,9,10) |
| InChIKey | ADVGKWPZRIDURE-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=CC=C1O)(=O)C |
| CAS DataBase Reference | 614-80-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetamide, N-(2-hydroxyphenyl)-(614-80-2) |
| EPA Substance Registry System | 2'-Hydroxyacetanilide (614-80-2) |
Description and Uses
An Acetaminophen (A161220) impurity.
2-Acetamidophenol is used as raw material to manufacture industrial organic chemicals.
Acetaminophen is an analgesic and antipyretic agent and used as a pain reliever to treat headache, muscle aches, and arthritis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/38-22-36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | AE4025000 |
| F | 1-8 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29242995 |
| Storage Class | 11 - Combustible Solids |







