A0648612
2-Acetylbenzoic acid , 98% , 577-56-0
Synonym(s):
3-Hydroxy-3-methylphthalide;Acetophenone-2-carboxylic acid
CAS NO.:577-56-0
Empirical Formula: C9H8O3
Molecular Weight: 164.16
MDL number: MFCD00002475
EINECS: 209-413-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB60.00 | In Stock |
|
| 25G | RMB240.00 | In Stock |
|
| 50g | RMB460.00 | In Stock |
|
| 100G | RMB905.60 | In Stock |
|
| 250G | RMB2239.20 | In Stock |
|
| 500g | RMB3919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 °C (lit.) |
| Boiling point: | 251.61°C (rough estimate) |
| Density | 1.2132 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Dichloromethane, Ethyl Acetate, Methanol (Slightly) |
| form | Crystalline Powder |
| pka | pK1: 4.13 (25°C) |
| color | Light yellow to light orange |
| Water Solubility | Soluble in Dichloromethane and Ethyl Acetate. Slightly soluble in water. |
| BRN | 1210557 |
| InChI | InChI=1S/C9H8O3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | QDAWXRKTSATEOP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1C(C)=O |
| CAS DataBase Reference | 577-56-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Acetylbenzoic acid(577-56-0) |
Description and Uses
A common component of hair dyes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280g-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29183000 |





