A0649012
2-Amino-6-chlorobenzoic acid , 98% , 2148-56-3
Synonym(s):
6-Chloroanthranilic acid
CAS NO.:2148-56-3
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00051530
EINECS: 218-416-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB179.20 | In Stock |
|
| 250G | RMB301.60 | In Stock |
|
| 500g | RMB572.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160 °C (lit.) |
| Boiling point: | 250°C (rough estimate) |
| Density | 1.3246 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder |
| pka | 0.97±0.10(Predicted) |
| color | Light yellow to beige |
| Water Solubility | Very soluble in water. Soluble in methanol. |
| BRN | 2804041 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6ClNO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | SZCPTRGBOVXVCA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(Cl)C=CC=C1N |
| CAS DataBase Reference | 2148-56-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-6-chlorobenzoic acid(2148-56-3) |
Description and Uses
2-Amino-6-chlorobenzoic acid is used as intermediate for medicine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




