![4-[4-(4-Aminophenoxy)phenoxy]aniline](https://img.chemicalbook.com/CAS/GIF/3491-12-1.gif)
PRODUCT Properties
| Melting point: | 173°C |
| Boiling point: | 483.6±40.0 °C(Predicted) |
| Density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Insoluble in water |
| pka | 5.20±0.10(Predicted) |
| InChI | InChI=1S/C18H16N2O2/c19-13-1-5-15(6-2-13)21-17-9-11-18(12-10-17)22-16-7-3-14(20)4-8-16/h1-12H,19-20H2 |
| InChIKey | JCRRFJIVUPSNTA-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=C(N)C=C2)=CC=C(OC2=CC=C(N)C=C2)C=C1 |
| CAS DataBase Reference | 3491-12-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Aniline, p,p'-(p-phenylenedioxy)di-(3491-12-1) |
Description and Uses
1,4-bis(4-aminophenoxy)benzene be used for preparation polyimide and epoxy resin material.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P501 |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | BY8237000 |
| HS Code | 29222990 |
