A0651712
5-Aminoisophthalic acid , 98% , 99-31-0
Synonym(s):
5-Aminobenzene-1,3-dicarboxylic acid;5-Aminoisophthalic acid
CAS NO.：99-31-0
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00002522
EINECS: 202-748-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB91.20 | In Stock |
|
| 500G | RMB345.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Store below +30°C. |
| form | Granular Powder |
| pka | 3.69±0.10(Predicted) |
| color | White to cream |
| Water Solubility | INSOLUBLE |
| BRN | 2805628 |
| InChI | InChI=1S/C8H7NO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) |
| InChIKey | KBZFDRWPMZESDI-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC(N)=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 99-31-0(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Aminoisophthalic acid (99-31-0) |
Description and Uses
5-Aminoisophthalic acid is a useful biochemical for proteomics research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 9 |
| TSCA | Yes |
| HS Code | 29224995 |
| Toxicity | LD50 orally in Rabbit: 1600 mg/kg |
