A0652812
3-Amino-2-pyrazinecarboxylic acid , 98% , 5424-01-1
CAS NO.:5424-01-1
Empirical Formula: C5H5N3O2
Molecular Weight: 139.11
MDL number: MFCD00006141
EINECS: 226-558-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100g | RMB399.20 | In Stock |
|
| 500g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-210 °C (dec.) (lit.) |
| Boiling point: | 255.04°C (rough estimate) |
| Density | 1.4551 (rough estimate) |
| refractive index | 1.5900 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly) , Methanol (Slightly) |
| pka | 3.65±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow-greenish |
| BRN | 124835 |
| InChI | InChI=1S/C5H5N3O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H2,6,8)(H,9,10) |
| InChIKey | ZAGZIOYVEIDDJA-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=CN=C1N |
| LogP | -3.1 at 20℃ and pH7 |
| Surface tension | 73.6mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 5424-01-1(CAS DataBase Reference) |
Description and Uses
Antidiabetic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |




