6-Aminofluorescein , >97%(HPLC) , 51649-83-3
Synonym(s):
Fluoresceinamine isomer II
CAS NO.:51649-83-3
Empirical Formula: C20H13NO5
Molecular Weight: 347.32
MDL number: MFCD00005051
EINECS: 257-334-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB290.40 | In Stock |
|
| 1G | RMB889.60 | In Stock |
|
| 5G | RMB2933.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 285 °C (dec.)(lit.) |
| Boiling point: | 481.89°C (rough estimate) |
| Density | 1.3724 (rough estimate) |
| refractive index | 1.5180 (estimate) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble1mg/mL, clear, yellow to very dark yellow-orange |
| form | Solid |
| pka | 9.34±0.20(Predicted) |
| color | Yellow to Orange |
| λmax | 495 nm |
| BRN | 51708 |
| Stability: | Light and Moisture Sensitive |
| InChI | InChI=1S/C20H13NO5/c21-10-1-4-13-16(7-10)20(26-19(13)24)14-5-2-11(22)8-17(14)25-18-9-12(23)3-6-15(18)20/h1-9,22-23H,21H2 |
| InChIKey | YOAWSYSKQHLFPM-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=C(O)C=C3)OC3=C1C=CC(O)=C3)C1=C(C=CC(N)=C1)C(=O)O2 |
| CAS DataBase Reference | 51649-83-3(CAS DataBase Reference) |
Description and Uses
6-Aminofluorescein (6-AF) is a new fluorescence dye with bright colors and high fluorescence intensity. Its chemical structure history contains a nitrogen group and a fluorescent group. The presence of the fluorescent component enables 6-Aminofluorescein to emit a distinct fluorescent signal when excited, making it valuable for fluorescent labeling and imaging. It is widely used in biological science research, chemical analysis and fluorescence microscopy.
Fluorescent labeling reagent for proteins. Glycosaminoglycuronans react with 6-aminofluorescein to yield fluorescent derivatives. Used in the fluorescent antibody technique for rapid identification of pathogens.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |




