A0654512
2-Amino-5-nitrobenzonitrile , 97% , 17420-30-3
Synonym(s):
2-Cyano-4-nitroaniline;5-Nitroanthranilonitrile
CAS NO.:17420-30-3
Empirical Formula: C7H5N3O2
Molecular Weight: 163.13
MDL number: MFCD00007362
EINECS: 241-446-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB33.60 | In Stock |
|
| 100G | RMB89.60 | In Stock |
|
| 500G | RMB380.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-207 °C(lit.) |
| Boiling point: | 290.19°C (rough estimate) |
| Density | 1.4141 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 234 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly) |
| form | Solid |
| pka | -1.97±0.10(Predicted) |
| color | Dark Yellow |
| BRN | 1425714 |
| InChI | InChI=1S/C7H5N3O2/c8-4-5-3-6(10(11)12)1-2-7(5)9/h1-3H,9H2 |
| InChIKey | MGCGMYPNXAFGFA-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1N |
| CAS DataBase Reference | 17420-30-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzonitrile, 2-amino-5-nitro- (17420-30-3) |
Description and Uses
5-Nitroanthranilonitrile is mainly used in the synthesis of disperse dyes and is an important intermediate for disperse dyes. It is used to synthesize various high-temperature or medium-temperature disperse dyes such as Disperse Ruby SE-GFL, Disperse Scarlet S-FL, Disperse Blue SE-2R, and Disperse Violet SR.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 2 |
| RTECS | BX2500000 |
| TSCA | TSCA listed |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,oral,6710mg/kg (6710mg/kg),Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 30(1), Pg. 50, 1986. |
| REACH Registrations | Inactive |





