A0655750
Anthracene-d10 , 98atom%D , 1719-06-8
Synonym(s):
1,2,3,4,5,6,7,8,9,10-Decadeuterioanthracene
CAS NO.:1719-06-8
Empirical Formula: C14D10
Molecular Weight: 188.29
MDL number: MFCD00001241
EINECS: 217-004-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB403.20 | In Stock |
|
| 250mg | RMB628.00 | In Stock |
|
| 1g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-215 °C (lit.) |
| Boiling point: | 340 °C (lit.) |
| Flash point: | 121 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated and Sonicated) |
| form | Solid |
| color | White to off-white |
| BRN | 2055675 |
| Major Application | electronics |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | MWPLVEDNUUSJAV-LHNTUAQVSA-N |
| SMILES | C12C([2H])=C([2H])C([2H])=C([2H])C=1C([2H])=C1C([2H])=C([2H])C([2H])=C([2H])C1=C2[2H] |
| CAS DataBase Reference | 1719-06-8(CAS DataBase Reference) |
| EPA Substance Registry System | Anthracene-d10 (1719-06-8) |
| CAS Number Unlabeled | 120-12-7 |
Description and Uses
May be used as an analytical standard
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H410 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N,T,Xn |
| Risk Statements | 36/37/38-50/53-63-43-23/24/25-45-67-52/53-40 |
| Safety Statements | 26-60-61-36/37-24/25-23-53 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| F | 10-21 |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |





