A0658812
1-Amino-2-naphthol-4-sulfonic Acid , ≥97%(T) , 116-63-2
Synonym(s):
1-Amino-2-hydroxy-4-naphthalenesulfonic acid;1-Amino-2-naphthol-4-sulfonic acid
CAS NO.:116-63-2
Empirical Formula: C10H9NO4S
Molecular Weight: 239.25
MDL number: MFCD00004019
EINECS: 204-147-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB237.60 | In Stock |
|
| 500g | RMB740.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C (dec.)(lit.) |
| bulk density | 280kg/m3 |
| Density | 1.4338 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -0.49±0.40(Predicted) |
| form | Powder |
| color | White to light pink |
| Water Solubility | insoluble |
| Merck | 14,454 |
| BRN | 2697469 |
| Stability: | Stable. Incompatible with strong bases, acid chlorides, acid anhydrides, strong oxidizing agents. |
| InChI | 1S/C10H9NO4S/c11-10-7-4-2-1-3-6(7)9(5-8(10)12)16(13,14)15/h1-5,12H,11H2,(H,13,14,15) |
| InChIKey | RXCMFQDTWCCLBL-UHFFFAOYSA-N |
| SMILES | Nc1c(O)cc(c2ccccc12)S(O)(=O)=O |
| CAS DataBase Reference | 116-63-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Naphthalenesulfonic acid,4-amino-3-hydroxy-(116-63-2) |
| EPA Substance Registry System | 1-Naphthalenesulfonic acid, 4-amino-3-hydroxy- (116-63-2) |
Description and Uses
4-Amino-3-hydroxy-1-naphthalenesulfonic acid is used as mordant dyes and acid dyes intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| RTECS | QK1292000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29222100 |
| Storage Class | 11 - Combustible Solids |




