PRODUCT Properties
| Melting point: | 197 °C (dec.)(lit.) |
| Boiling point: | 316.88°C (rough estimate) |
| alpha | -0.5~+0.5°(D/20)(c=1,0.1mol/l HCl) |
| Density | 1.1967 (rough estimate) |
| refractive index | 1.4760 (estimate) |
| storage temp. | 2-8°C |
| solubility | 0.1 M HCL : 2.5 mg/mL (13.65 mM; ultrasonic and adjust pH to 1 with HCl)DMSO : 1 mg/mL (5.46 mM; ultrasonic and adjust pH to 7 with HCl)Ethanol : < 1 mg/mL (insoluble)H2O : < 0.1 mg/mL (insoluble) |
| form | Powder |
| pka | 9.60±0.10(Predicted) |
| Water Solubility | Sparingly soluble |
| Sensitive | Light Sensitive |
| Merck | 14,3619 |
| InChI | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3 |
| InChIKey | UCTWMZQNUQWSLP-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(O)CNC)C=C1O |
| CAS DataBase Reference | 329-65-7(CAS DataBase Reference) |
| EPA Substance Registry System | 4-[1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol (329-65-7) |
Description and Uses
A hormone and neurotransmitter
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H311-H315-H319-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 24-36/37/38 |
| Safety Statements | 26-36/37-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DO2975000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |







