A0667512
Atropine sulfate monohydrate , 98.5% , 5908-99-6
Synonym(s):
α-(Hydroxymethyl)benzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester;Atropini sulfas;Tropine tropate
CAS NO.：5908-99-6
Empirical Formula: C17H25NO7S
Molecular Weight: 387.45
MDL number: MFCD00074815
EINECS: 611-792-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB365.60 | In Stock |
|
| 100G | RMB956.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-192 °C (A)(lit.) |
| alpha | -0.6 º (per USP 25 ºC) |
| storage temp. | Poison room |
| solubility | H2O: soluble2.5g/mL (stable for several days at 4°C.) |
| form | Powder |
| color | white |
| Water Solubility | soluble |
| Sensitive | Light Sensitive |
| Merck | 14,875 |
| BRN | 6109275 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C17H23NO3.H2O4S/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12;1-5(2,3)4/h2-6,13-16,19H,7-11H2,1H3;(H2,1,2,3,4)/t13-,14+,15+,16?; |
| InChIKey | VJFQPODMEGSXHC-RIMUKSHENA-N |
| SMILES | O([C@@H]1C[C@@H]2CC[C@@H](N2C)C1)C(=O)C(C1C=CC=CC=1)CO.S(O)(O)(=O)=O |&1:1,3,6,r| |
| LogP | 2.137 (est) |
| CAS DataBase Reference | 5908-99-6(CAS DataBase Reference) |
Description and Uses
mydriatic and anticholinergie agent in ophthalmie preparations and pre-anesthetie medications; antidote to organophosphous insecticides
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330 |
| Precautionary statements | P301+P310+P330-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 26/28-43-36/37/38 |
| Safety Statements | 23-45-36/37/39-26-1-25 |
| RIDADR | UN 1544 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | CK2455000 |
| F | 3-8-10 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29399900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
