A0668012
4-Amino-3-hydroxybenzoic acid , 98% , 2374-03-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB188.00 | In Stock |
|
| 100G | RMB645.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-215 °C (lit.) |
| Boiling point: | 385.7±37.0 °C(Predicted) |
| Density | 1.028 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.74±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow-brown to brown |
| Water Solubility | Soluble in chloroform, and aqeous ethanol, water (Partly miscible) |
| BRN | 509859 |
| InChI | InChI=1S/C7H7NO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,8H2,(H,10,11) |
| InChIKey | NFPYJDZQOKCYIE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C(O)=C1 |
| CAS DataBase Reference | 2374-03-0(CAS DataBase Reference) |
Description and Uses
4-Amino-3-hydroxybenzoic acid is used in the preparation of various pharmaceutical compounds such as sphingosine kinase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29225090 |
