A0668312
Amantadine hydrochloride , 99%(T) , 665-66-7
Synonym(s):
Amantadine hydrochloride;1-Adamantanamine hydrochloride;1-Aminoadamantane hydrochloride;1-Adamantaneammonium chloride;1-Adamantylamine hydrochloride
CAS NO.:665-66-7
Empirical Formula: C10H18ClN
Molecular Weight: 187.71
MDL number: MFCD00074723
EINECS: 211-560-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB55.20 | In Stock |
|
| 500G | RMB225.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 308.63°C (rough estimate) |
| Density | 1.0276 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | H2O: 50 mg/mL |
| form | Fine Crystalline Powder |
| color | White |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Merck | 14,374 |
| BRN | 4198854 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C10H17N.ClH/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6,11H2;1H/t7-,8+,9-,10-; |
| InChIKey | WOLHOYHSEKDWQH-UHFFFAOYSA-N |
| SMILES | Cl[H].[H][C@@]12C[C@@]3([H])C[C@@]([H])(C1)CC(N)(C2)C3 |
| LogP | -1.64 at 23℃ and pH6.3 |
| CAS DataBase Reference | 665-66-7(CAS DataBase Reference) |
| EPA Substance Registry System | Amantadine hydrochloride (665-66-7) |
Description and Uses
selective FP prostanoid receptor agonist, F-series prostaglandin analog. 200 times as potent as Latanoprost -20oC
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22-40-20/21/22 |
| Safety Statements | 22-36/37-36-35-20/21 |
| RIDADR | UN 1759 8 / PGII |
| WGK Germany | 3 |
| RTECS | AU4375000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29213000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orally in mice, rats: 700, 1275 mg/kg (Vernier) |





