A0673512
5-Aminofluorescein , 96% , 3326-34-9
CAS NO.:3326-34-9
Empirical Formula: C20H13NO5
Molecular Weight: 347.32
MDL number: MFCD00005052
EINECS: 222-043-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB167.20 | In Stock |
|
| 1G | RMB317.60 | In Stock |
|
| 5G | RMB1423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223 °C (dec.)(lit.) |
| Boiling point: | 481.89°C (rough estimate) |
| Density | 1.3724 (rough estimate) |
| refractive index | 1.5180 (estimate) |
| storage temp. | room temp |
| solubility | DMF: 5 mg/ml; DMSO: 5 mg/ml |
| pka | 9.34±0.20(Predicted) |
| form | powder |
| color | red-brown |
| Appearance | Solid Powder |
| Water Solubility | Soluble in water (partly), methanol (10 mg/ml), and acetone. |
| λmax | 496 nm |
| BRN | 48395 |
| Stability: | Light and Moisture Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C20H13NO5/c21-10-1-4-14-13(7-10)19(24)26-20(14)15-5-2-11(22)8-17(15)25-18-9-12(23)3-6-16(18)20/h1-9,22-23H,21H2 |
| InChIKey | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)OC23c4ccc(O)cc4Oc5cc(O)ccc35 |
| CAS DataBase Reference | 3326-34-9(CAS DataBase Reference) |
| EPA Substance Registry System | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 5-amino-3',6'-dihydroxy- (3326-34-9) |
Description and Uses
5-AMF is a fluorescent probe for carboxylic acids and glutamine, and it also can be coupled to aldehydes and ketones.
5-aminofluorescein is also used to prepare FITC Isomer I (CDX-F0011, CDX-F0020). It is a chemical used as molecular probe and important as fluorescent dye and for derivatives. Fluorescent labeling reagent for proteins. Used in the fluorescent antibody technique for rapid identification of pathogens.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 32049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



