PRODUCT Properties
| Melting point: | -14.3 °C |
| Boiling point: | 108 °C(Press: 13 Torr) |
| Density | 1.0079 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C10H12O/c1-7-5-4-6-10(8(7)2)9(3)11/h4-6H,1-3H3 |
| InChIKey | YXJIYJZHAPHBHG-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(C)=C1C)C |
Description and Uses
2,3-Dimethylacetophenone is used in the preparation of molecules with in vitro anti-mycobacterial activities
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 2914390090 |







