A0679850
PropazineSolutioninMethanol , 1000μg/mlinMethanol , 139-40-2
Synonym(s):
2,4-Bis(isopropylamino)-6-chloro-1,3,5-triazine
CAS NO.:139-40-2
Empirical Formula: C9H16ClN5
Molecular Weight: 229.71
MDL number: MFCD00047341
EINECS: 205-359-9
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212-214°C |
| Boiling point: | 368.7°C (rough estimate) |
| Density | 1.162 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.6110 (estimate) |
| Flash point: | 11 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Heated), DMSO (Slightly), Methanol (Slightly) |
| pka | 2.28±0.10(Predicted) |
| Water Solubility | 8.6mg/L(22 ºC) |
| Merck | 13,7904 |
| BRN | 747081 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C9H16ClN5/c1-5(2)11-8-13-7(10)14-9(15-8)12-6(3)4/h5-6H,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | WJNRPILHGGKWCK-UHFFFAOYSA-N |
| SMILES | CC(C)Nc1nc(Cl)nc(NC(C)C)n1 |
| LogP | 3.01 at 25℃ and pH7.1 |
| CAS DataBase Reference | 139-40-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Triazine-2,4-diamine, 6-chloro-N,N'-bis(1-methylethyl)-(139-40-2) |
| EPA Substance Registry System | Propazine (139-40-2) |
Description and Uses
2,4-Bis(isopropylamino)-6-chloro-1,3,5-triazine is used to control annual grasses and broad-leaved weeds in milo and sweet sorghum.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H410 |
| Precautionary statements | P201-P273-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn;N,N,Xn,T,F |
| Risk Statements | 40-50/53-39/23/24/25-23/24/25-11 |
| Safety Statements | 36/37-60-61-45-24-16-7 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | XY5300000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29336990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| Hazardous Substances Data | 139-40-2(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >5000 mg/kg (Bailey, White) |





