A0681912
Acetic acid-d<sub>4</sub> , (D,99.9%) , 1186-52-3
Synonym(s):
Acetic (acid-d);Acetic-d3 acid-d;Monodeuteroacetic acid;mono-Deuteroacetic acid;Tetradeuteroacetic acid
CAS NO.:1186-52-3
Empirical Formula: C2D4O2
Molecular Weight: 64.08
MDL number: MFCD00051051
EINECS: 214-693-4
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB959.20 | In Stock |
|
| 10×0.75ml | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15-16 °C(lit.) |
| Melting point: | 16,7°C |
| Boiling point: | 118°C |
| Boiling point: | 115.5 °C(lit.) |
| Density | 1.119 g/mL at 25 °C(lit.) |
| Density | d = 1,12 |
| vapor density | 2.07 (vs air) |
| vapor pressure | 11.4 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 104 °F |
| storage temp. | Flammables area |
| solubility | Benzene |
| form | Liquid |
| pka | pK1: 5.32(Sol. D2O) |
| Specific Gravity | 1.12 |
| color | Colorless |
| PH | 2.5 (50g/l, H2O, 25℃) |
| explosive limit | 4-19.9%(V) |
| Water Solubility | Soluble in water, ethanol and ether. |
| Sensitive | Moisture Sensitive |
| BRN | 1748971 |
| Stability: | Stable. Incompatible with acids, bases, oxidizing agents, carbonates and phosphates, hydroxides, metals, oxides, acid anhydrides, peroxides, permanganates, amines, alcohols. Protect from moisture. Flammable. |
| InChI | 1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| InChIKey | QTBSBXVTEAMEQO-GUEYOVJQSA-N |
| SMILES | [2H]OC(=O)C([2H])([2H])[2H] |
| CAS DataBase Reference | 1186-52-3(CAS DataBase Reference) |
Description and Uses
Acetic acid-d4 may be used in the synthesis of deuterated (7E,9Z)-CLA (conjugated linoleic acid) and Pr(CD3COO)3.D2O (deuterium analog of praseodymium (III) acetate hydrate).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 10-35 |
| Safety Statements | 23-26-45 |
| RIDADR | UN 2789 8/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| Autoignition Temperature | 800 °F |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1A |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






