A0683912
Asiatic acid , 98% , 464-92-6
Synonym(s):
2α,23-Dihydroxyursolic acid;Dammarolic acid;NSC 166063
CAS NO.:464-92-6
Empirical Formula: C30H48O5
Molecular Weight: 488.7
MDL number: MFCD00238541
EINECS: 482-720-9
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB71.20 | In Stock |
|
| 200mg | RMB175.20 | In Stock |
|
| 500mg | RMB399.20 | In Stock |
|
| 1G | RMB719.20 | In Stock |
|
| 5G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 325-330 °C(lit.) |
| Boiling point: | 609.4±55.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| RTECS | YU9580000 |
| storage temp. | 2-8°C |
| solubility | methanol: soluble1mg/mL, clear, colorless |
| pka | 4.66±0.70(Predicted) |
| form | powder |
| color | white |
| biological source | Centella asiatica |
| Water Solubility | Soluble in dimethyl sulfoxide, ethanol and dimethylformamide. Sparingly soluble in water |
| Cosmetics Ingredients Functions | SKIN CONDITIONING LIGHT STABILIZER |
| InChIKey | JXSVIVRDWWRQRT-UYDOISQJSA-N |
| SMILES | C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@@]34C)[C@@H]2[C@H]1C)C(O)=O |
| LogP | 5.748 (est) |
| CAS DataBase Reference | 464-92-6(CAS DataBase Reference) |
Description and Uses
wound healing, experimental carcinogen
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P501-P273 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 464-92-6(Hazardous Substances Data) |



