A0684112
2-Amino-4-cyanopyridine , 97% , 42182-27-4
CAS NO.：42182-27-4
Empirical Formula: C6H5N3
Molecular Weight: 119.12
MDL number: MFCD03791310
EINECS: 677-660-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.00 | In Stock |
|
| 5G | RMB196.00 | In Stock |
|
| 25G | RMB844.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148°C |
| Boiling point: | 297.7±20.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.93±0.11(Predicted) |
| Appearance | Off-white to light yellow Solid |
| Water Solubility | Slightly soluble in water. |
| BRN | 386393 |
| InChI | InChI=1S/C6H5N3/c7-4-5-1-2-9-6(8)3-5/h1-3H,(H2,8,9) |
| InChIKey | GEEAYLFEIFJFGP-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(C#N)=C1 |
| CAS DataBase Reference | 42182-27-4(CAS DataBase Reference) |
Description and Uses
2-Amino-4-cyanopyridine is a pyridine derivative as mGluR2 antagonists; used in the treatment of CNS disorders.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H311-H319 |
| Precautionary statements | P280f-P305+P351+P338-P309-P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-36-39 |
| RIDADR | 3439 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
