A0686712
D-(-)-Arabinose , 98% , 10323-20-3
Synonym(s):
D -(−)-Arabinose
CAS NO.:10323-20-3
Empirical Formula: C5H10O5
Molecular Weight: 150.13
MDL number: MFCD00135608
EINECS: 233-708-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 10G | RMB49.60 | In Stock |
|
| 25G | RMB78.40 | In Stock |
|
| 50g | RMB127.20 | In Stock |
|
| 100G | RMB198.40 | In Stock |
|
| 250g | RMB447.20 | In Stock |
|
| 500G | RMB844.80 | In Stock |
|
| 2.5kg | RMB4159.20 | In Stock |
|
| 10kg | RMB12799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-160 °C |
| Boiling point: | 191.65°C (rough estimate) |
| Density | 1.1897 (rough estimate) |
| refractive index | -104 ° (C=10, H2O) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | insoluble in EtOH; >21.55 mg/mL in DMSO; |
| form | Solid |
| pka | pK1: 12.34 (25°C) |
| color | White powder |
| Odor | Odorless |
| optical activity | [α]20/D 104±2.0°, 24 hr, c = 10% in H2O |
| Water Solubility | Soluble in water. |
| BRN | 1723079 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING HUMECTANT |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-ZRMNMSDTSA-N |
| SMILES | O[C@@H]1COC(O)[C@@H](O)[C@@H]1O |
| LogP | -2.812 (est) |
| CAS DataBase Reference | 10323-20-3(CAS DataBase Reference) |
| NIST Chemistry Reference | D-Arabinose(10323-20-3) |
| EPA Substance Registry System | D-Arabinose (10323-20-3) |
Description and Uses
D-(-)-Arabinose is used in culture media for some bacteria. It serves as a component of biopolymers such as hemicellulose and pectin. In the synthetic biology laboratory, it is employed as a reversible switch for protein expression under the Pbad promoter (i.e. part of plasmids) in E. coli. Further, it acts as an inhibitor of the enzyme glucose dehydrogenase. In addition to this, it is used as a pharmaceutical intermediate and food additive.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |






