A0692356
PropyzamideSolutioninAcetonitrile , 1000 μg/mlinaCetonitrile, uncertainty 2% , 23950-58-5
Synonym(s):
Pronamide;Propyzamide
CAS NO.:23950-58-5
Empirical Formula: C12H11Cl2NO
Molecular Weight: 256.13
MDL number: MFCD00055346
EINECS: 245-951-4
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155°C |
| Boiling point: | 340.9±42.0 °C(Predicted) |
| Density | 1.2742 (rough estimate) |
| refractive index | 1.5490 (estimate) |
| Flash point: | 2 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.30±0.46(Predicted) |
| color | White to Almost white |
| Water Solubility | 15mg/L(25 ºC) |
| λmax | 289nm(lit.) |
| Merck | 14,7872 |
| BRN | 882391 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C12H11Cl2NO/c1-4-12(2,3)15-11(16)8-5-9(13)7-10(14)6-8/h1,5-7H,2-3H3,(H,15,16) |
| InChIKey | PHNUZKMIPFFYSO-UHFFFAOYSA-N |
| SMILES | CC(C)(NC(=O)c1cc(Cl)cc(Cl)c1)C#C |
| LogP | 3.430 |
| CAS DataBase Reference | 23950-58-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Propyzamide(23950-58-5) |
| EPA Substance Registry System | Pronamide (23950-58-5) |
Description and Uses
Selective pre-emergence herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H410 |
| Precautionary statements | P201-P273-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn;N,N,Xn,F |
| Risk Statements | 40-50/53-36-20/21/22-11 |
| Safety Statements | 36/37-60-61-36-26 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | CV3460000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| Hazardous Substances Data | 23950-58-5(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (mg/kg): 8350, 5620 orally (Viste) |






