A0696912
Adenine hemisulfate salt , Used for cell culture, 98% , 321-30-2
Synonym(s):
6-Aminopurine hemisulfate salt;Adenine sulfate salt
CAS NO.：321-30-2
Empirical Formula: C10H12N10O4S
Molecular Weight: 368.33
MDL number: MFCD00213655
EINECS: 206-286-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB309.60 | In Stock |
|
| 25G | RMB1039.20 | In Stock |
|
| 100G | RMB2869.60 | In Stock |
|
| 500G | RMB10399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 0.5 M HCl: 10 mg/mL |
| form | powder |
| color | White to slightly yellow |
| biological source | synthetic (organic) |
| Water Solubility | 0.4 g/100 mL |
| Sensitive | Hygroscopic |
| Merck | 14,152 |
| BRN | 3820263 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/2C5H5N5.H2O4S/c2*6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h2*1-2H,(H3,6,7,8,9,10);(H2,1,2,3,4) |
| InChIKey | LQXHSCOPYJCOMD-UHFFFAOYSA-N |
| SMILES | C12N=CN=C(N)C=1NC=N2.C12N=CN=C(N)C=1NC=N2.S(=O)(=O)(O)O |
| CAS DataBase Reference | 321-30-2(CAS DataBase Reference) |
| EPA Substance Registry System | Adenine sulfate (2:1) (321-30-2) |
Description and Uses
Adenine hemisulfate salt has been used as a component of:
complete supplement mixture (CSM)
yeast extract with supplements (YES) medium for culturing S. pombe strain
synthetic complete glucose-based yeast media (SC) for S. cerevisiae cultures
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-20/21/22 |
| Safety Statements | 22-24/25-36 |
| WGK Germany | 3 |
| RTECS | AU7140000 |
| F | 8 |
| TSCA | Yes |
| HS Code | 29335990 |
