A0699050
VE-822(Berzosertib) , 98% , 1232416-25-9
CAS NO.:1232416-25-9
Empirical Formula: C24H25N5O3S
Molecular Weight: 463.55
MDL number:
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB331.20 | In Stock |
|
| 10mg | RMB599.20 | In Stock |
|
| 25mg | RMB1351.20 | In Stock |
|
| 50mg | RMB2347.20 | In Stock |
|
| 100mg | RMB4159.20 | In Stock |
|
| 250mg | RMB8991.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >197°C (dec.) |
| Boiling point: | 674.4±55.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 8.88±0.10(Predicted) |
| form | Solid |
| color | Light Yellow |
| InChIKey | JZCWLJDSIRUGIN-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(C2=CC=C(S(C(C)C)(=O)=O)C=C2)N=C1C1ON=C(C2=CC=C(CNC)C=C2)C=1 |
Description and Uses
3-[3-[4-[(Methylamino)methyl]phenyl]-5-isoxazolyl]-5-[4-[(1-methylethyl)sulfonyl]phenyl]-2-pyrazinamine is a novel ATR (ATM-Rad3-related) inhibitor for in vitro and in vivo radiosensatization.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |







