A0703150
Acrylicanhydride , 97% , 2051-76-5
CAS NO.:2051-76-5
Empirical Formula: C6H6O3
Molecular Weight: 126.11
MDL number: MFCD00048146
EINECS: 218-128-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB88.80 | In Stock |
|
| 25g | RMB312.00 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -20 °C |
| Boiling point: | 85-86°C 17mm |
| Density | 1,094 g/cm3 |
| Flash point: | 77°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Moisture sensitive |
| InChI | InChI=1S/C6H6O3/c1-3-5(7)9-6(8)4-2/h3-4H,1-2H2 |
| InChIKey | ARJOQCYCJMAIFR-UHFFFAOYSA-N |
| SMILES | C(=O)(C=C)OC(=O)C=C |
| CAS DataBase Reference | 2051-76-5(CAS DataBase Reference) |
Description and Uses
Acrylic anhydride can be used to prepare specialty acrylate, acrylamide monomers or acrylic resin. It forms cyclic anhydrides on polymerization and can not be used as a crosslinker.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Risk Statements | 14-20/21/22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| WGK Germany | WGK 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2916199590 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







