A0703312
4-Amino-2,6-dichloropyridine , 97% , 2587-02-2
Synonym(s):
2,6-Dichloro-4-aminopyridine
CAS NO.：2587-02-2
Empirical Formula: C5H4Cl2N2
Molecular Weight: 163
MDL number: MFCD00052832
EINECS: 629-221-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.80 | In Stock |
|
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-173 °C (lit.) |
| Boiling point: | 336.7±37.0 °C(Predicted) |
| Density | 1.497±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 0.49±0.50(Predicted) |
| form | Powder |
| color | White to buff |
| BRN | 114351 |
| InChI | InChI=1S/C5H4Cl2N2/c6-4-1-3(8)2-5(7)9-4/h1-2H,(H2,8,9) |
| InChIKey | WAEZOSSWRXDWAX-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC(N)=C1 |
| CAS DataBase Reference | 2587-02-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 4-amino-2,6-dichloro-(2587-02-2) |
Description and Uses
4-Amino-2,6-dichloropyridine is a compound useful in organic synthesis used in the synthesis of Rho kinase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
