A0703512
2-Amino-4,6-dichloropyrimidine , 98% , 56-05-3
CAS NO.:56-05-3
Empirical Formula: C4H3Cl2N3
Molecular Weight: 163.99
MDL number: MFCD00006090
EINECS: 200-253-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB36.00 | In Stock |
|
| 100G | RMB83.20 | In Stock |
|
| 500G | RMB388.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 219-222 °C (lit.) |
| Boiling point: | 219-222°C |
| Density | 1.6662 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 0.14±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to light yellow |
| Water Solubility | Insoluble in water, soluble in acetone, two monomer (VCM) and thermal toluene. |
| BRN | 118454 |
| InChI | InChI=1S/C4H3Cl2N3/c5-2-1-3(6)9-4(7)8-2/h1H,(H2,7,8,9) |
| InChIKey | JPZOAVGMSDSWSW-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(Cl)=CC(Cl)=N1 |
| CAS DataBase Reference | 56-05-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Pyrimidinamine, 4,6-dichloro- (56-05-3) |
Description and Uses
Microwave-assisted synthesis of pyrazolo [3, 4-d] pyrimidines from 2-amino-4, 6-dichloropyrimidine-5-carbaldehyde is under solvent-free conditions. A series of 6-alkynyl-2,4-diaminopyrimidine derivatives bearing various substituents at alkynyl moiety was prepared by the Sonogashira cross-coupling reaction of 2,4-diamino-6-iodopyrimidine using Pd(PPh3)2Cl2 as catalyst.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | UV6260485 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29335995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






