A0704512
4-Amino-3-methylbenzoic acid , 98% , 2486-70-6
CAS NO.：2486-70-6
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00007736
EINECS: 219-629-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB150.40 | In Stock |
|
| 500G | RMB673.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-171 °C (lit.) |
| Boiling point: | 273.17°C (rough estimate) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.93±0.10(Predicted) |
| color | Pale Brown to Light Brown |
| BRN | 2802615 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C8H9NO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | NHFKECPTBZZFBC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C(C)=C1 |
| CAS DataBase Reference | 2486-70-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Amino-3-methylbenzoic acid(2486-70-6) |
Description and Uses
4-Amino-3-methylbenzoic Acid is used in preparation of Amide-substituted Benzo[d]imidazole compounds as selective inhibitors of indoleamine-2,3-dioxygenases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
